C15H22F2N2O — CID 109033102
3-(3,4-difluoroanilino)-N,N-dipropylpropanamide (PubChem CID 109033102) has the molecular formula C15H22F2N2O and a molecular weight of 284.35 g/mol. Its IUPAC name is 3-(3,4-difluoroanilino)-N,N-dipropylpropanamide.
| Compound Name | 3-(3,4-difluoroanilino)-N,N-dipropylpropanamide |
|---|---|
| PubChem CID | 109033102 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 3-(3,4-difluoroanilino)-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)CCNc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H22F2N2O/c1-3-9-19(10-4-2)15(20)7-8-18-12-5-6-13(16)14(17)11-12/h5-6,11,18H,3-4,7-10H2,1-2H3 |
| InChIKey | MYEJFRYVLNRFHV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |