C15H21Cl2FN2O — CID 60925290
3-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]-N,N-diethylpropanamide (PubChem CID 60925290) has the molecular formula C15H21Cl2FN2O and a molecular weight of 335.25 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]-N,N-diethylpropanamide.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 60925290 |
| Molecular Formula | C15H21Cl2FN2O |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNC(C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C15H21Cl2FN2O/c1-4-20(5-2)13(21)8-9-19-10(3)14-11(16)6-7-12(18)15(14)17/h6-7,10,19H,4-5,8-9H2,1-3H3 |
| InChIKey | QLYAJVBLWDYLJM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|