C14H20Cl2FNO2 — CID 79548563
N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2,2-diethoxyethanamine (PubChem CID 79548563) has the molecular formula C14H20Cl2FNO2 and a molecular weight of 324.22 g/mol. Its IUPAC name is N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2,2-diethoxyethanamine.
| Compound Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 79548563 |
| Molecular Formula | C14H20Cl2FNO2 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2,2-diethoxyethanamine |
| SMILES | CCOC(CNC(C)c1c(Cl)ccc(F)c1Cl)OCC |
| InChI | InChI=1S/C14H20Cl2FNO2/c1-4-19-12(20-5-2)8-18-9(3)13-10(15)6-7-11(17)14(13)16/h6-7,9,12,18H,4-5,8H2,1-3H3 |
| InChIKey | RGCKMSCPNYHZRB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|