C12H16Cl2FNO2 — CID 122131753
(2S)-1-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]-3-methoxypropan-2-ol (PubChem CID 122131753) has the molecular formula C12H16Cl2FNO2 and a molecular weight of 296.17 g/mol. Its IUPAC name is (2S)-1-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]-3-methoxypropan-2-ol.
| Compound Name | (2S)-1-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 122131753 |
| Molecular Formula | C12H16Cl2FNO2 |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | (2S)-1-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]-3-methoxypropan-2-ol |
| SMILES | COC[C@@H](O)CNC(C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C12H16Cl2FNO2/c1-7(16-5-8(17)6-18-2)11-9(13)3-4-10(15)12(11)14/h3-4,7-8,16-17H,5-6H2,1-2H3/t7?,8-/m0/s1 |
| InChIKey | GPEIHTROFPDVTC-MQWKRIRWSA-N |
| XLogP | 2.79 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|