C13H18Cl3FN2O2 — CID 86813916
N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 86813916) has the molecular formula C13H18Cl3FN2O2 and a molecular weight of 359.66 g/mol. Its IUPAC name is N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 86813916 |
| Molecular Formula | C13H18Cl3FN2O2 |
| Molecular Weight | 359.66 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NC(C)c1c(Cl)ccc(F)c1Cl.Cl |
| InChI | InChI=1S/C13H17Cl2FN2O2.ClH/c1-8(18-11(19)7-17-5-6-20-2)12-9(14)3-4-10(16)13(12)15;/h3-4,8,17H,5-7H2,1-2H3,(H,18,19);1H |
| InChIKey | CSPDUEOISZETSF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.66 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|