C10H10Cl2FNO2 — CID 43545181
2-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]acetic acid (PubChem CID 43545181) has the molecular formula C10H10Cl2FNO2 and a molecular weight of 266.10 g/mol. Its IUPAC name is 2-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]acetic acid.
| Compound Name | 2-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]acetic acid |
|---|---|
| PubChem CID | 43545181 |
| Molecular Formula | C10H10Cl2FNO2 |
| Molecular Weight | 266.10 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 2-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]acetic acid |
| SMILES | CC(NCC(=O)O)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C10H10Cl2FNO2/c1-5(14-4-8(15)16)9-6(11)2-3-7(13)10(9)12/h2-3,5,14H,4H2,1H3,(H,15,16) |
| InChIKey | DHZVIVDOLAGLIX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.10 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|