C13H18Cl2FNOS — CID 115894601
N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-methylsulfinylbutan-1-amine (PubChem CID 115894601) has the molecular formula C13H18Cl2FNOS and a molecular weight of 326.26 g/mol. Its IUPAC name is N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-methylsulfinylbutan-1-amine.
| Compound Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-methylsulfinylbutan-1-amine |
|---|---|
| PubChem CID | 115894601 |
| Molecular Formula | C13H18Cl2FNOS |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-methylsulfinylbutan-1-amine |
| SMILES | CC(NCCC(C)S(C)=O)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C13H18Cl2FNOS/c1-8(19(3)18)6-7-17-9(2)12-10(14)4-5-11(16)13(12)15/h4-5,8-9,17H,6-7H2,1-3H3 |
| InChIKey | BGXWWQISVXFILY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|