C13H19F2NOS — CID 115894604
N-[1-(3,5-difluorophenyl)ethyl]-3-methylsulfinylbutan-1-amine (PubChem CID 115894604) has the molecular formula C13H19F2NOS and a molecular weight of 275.36 g/mol. Its IUPAC name is N-[1-(3,5-difluorophenyl)ethyl]-3-methylsulfinylbutan-1-amine.
| Compound Name | N-[1-(3,5-difluorophenyl)ethyl]-3-methylsulfinylbutan-1-amine |
|---|---|
| PubChem CID | 115894604 |
| Molecular Formula | C13H19F2NOS |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-[1-(3,5-difluorophenyl)ethyl]-3-methylsulfinylbutan-1-amine |
| SMILES | CC(NCCC(C)S(C)=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H19F2NOS/c1-9(18(3)17)4-5-16-10(2)11-6-12(14)8-13(15)7-11/h6-10,16H,4-5H2,1-3H3 |
| InChIKey | WFIGZBJFQRJOAI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |