C13H19BrFNOS — CID 99577329
(3R)-N-[(1S)-1-(4-bromo-2-fluorophenyl)ethyl]-3-[(S)-methylsulfinyl]butan-1-amine (PubChem CID 99577329) has the molecular formula C13H19BrFNOS and a molecular weight of 336.27 g/mol. Its IUPAC name is (3R)-N-[(1S)-1-(4-bromo-2-fluorophenyl)ethyl]-3-[(S)-methylsulfinyl]butan-1-amine.
| Compound Name | (3R)-N-[(1S)-1-(4-bromo-2-fluorophenyl)ethyl]-3-[(S)-methylsulfinyl]butan-1-amine |
|---|---|
| PubChem CID | 99577329 |
| Molecular Formula | C13H19BrFNOS |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | (3R)-N-[(1S)-1-(4-bromo-2-fluorophenyl)ethyl]-3-[(S)-methylsulfinyl]butan-1-amine |
| SMILES | C[C@H](NCC[C@@H](C)[S@](C)=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C13H19BrFNOS/c1-9(18(3)17)6-7-16-10(2)12-5-4-11(14)8-13(12)15/h4-5,8-10,16H,6-7H2,1-3H3/t9-,10+,18+/m1/s1 |
| InChIKey | XRPXKFAWVUUINM-JJQCHNSYSA-N |
| XLogP | 3.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |