C14H22FNOS — CID 113348963
N-[1-(3-fluoro-4-methylphenyl)ethyl]-3-methylsulfinylbutan-1-amine (PubChem CID 113348963) has the molecular formula C14H22FNOS and a molecular weight of 271.40 g/mol. Its IUPAC name is N-[1-(3-fluoro-4-methylphenyl)ethyl]-3-methylsulfinylbutan-1-amine.
| Compound Name | N-[1-(3-fluoro-4-methylphenyl)ethyl]-3-methylsulfinylbutan-1-amine |
|---|---|
| PubChem CID | 113348963 |
| Molecular Formula | C14H22FNOS |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[1-(3-fluoro-4-methylphenyl)ethyl]-3-methylsulfinylbutan-1-amine |
| SMILES | Cc1ccc(C(C)NCCC(C)S(C)=O)cc1F |
| InChI | InChI=1S/C14H22FNOS/c1-10-5-6-13(9-14(10)15)12(3)16-8-7-11(2)18(4)17/h5-6,9,11-12,16H,7-8H2,1-4H3 |
| InChIKey | GJKGNYRQYCYYBT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |