C19H32FN3 — CID 124625047
N-[(1R)-1-(3-fluoro-4-methylphenyl)ethyl]-3-(4-propan-2-ylpiperazin-1-yl)propan-1-amine (PubChem CID 124625047) has the molecular formula C19H32FN3 and a molecular weight of 321.48 g/mol. Its IUPAC name is N-[(1R)-1-(3-fluoro-4-methylphenyl)ethyl]-3-(4-propan-2-ylpiperazin-1-yl)propan-1-amine.
| Compound Name | N-[(1R)-1-(3-fluoro-4-methylphenyl)ethyl]-3-(4-propan-2-ylpiperazin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 124625047 |
| Molecular Formula | C19H32FN3 |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.26 |
| IUPAC Name | N-[(1R)-1-(3-fluoro-4-methylphenyl)ethyl]-3-(4-propan-2-ylpiperazin-1-yl)propan-1-amine |
| SMILES | Cc1ccc([C@@H](C)NCCCN2CCN(C(C)C)CC2)cc1F |
| InChI | InChI=1S/C19H32FN3/c1-15(2)23-12-10-22(11-13-23)9-5-8-21-17(4)18-7-6-16(3)19(20)14-18/h6-7,14-15,17,21H,5,8-13H2,1-4H3/t17-/m1/s1 |
| InChIKey | KVTNNAJZZCGNHG-QGZVFWFLSA-N |
| XLogP | 3.20 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|