C19H26FN5 — CID 71969184
1-(3-fluoro-4-methylphenyl)-N-[[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methyl]ethanamine (PubChem CID 71969184) has the molecular formula C19H26FN5 and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-N-[[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methyl]ethanamine.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-N-[[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 71969184 |
| Molecular Formula | C19H26FN5 |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-N-[[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methyl]ethanamine |
| SMILES | Cc1ccc(C(C)NCc2cnc(N3CCN(C)CC3)nc2)cc1F |
| InChI | InChI=1S/C19H26FN5/c1-14-4-5-17(10-18(14)20)15(2)21-11-16-12-22-19(23-13-16)25-8-6-24(3)7-9-25/h4-5,10,12-13,15,21H,6-9,11H2,1-3H3 |
| InChIKey | UJPUTRQXDLNFAW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |