C22H30FN3O — CID 60584518
N-[(3-ethoxyphenyl)methyl]-1-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]ethanamine (PubChem CID 60584518) has the molecular formula C22H30FN3O and a molecular weight of 371.50 g/mol. Its IUPAC name is N-[(3-ethoxyphenyl)methyl]-1-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]ethanamine.
| Compound Name | N-[(3-ethoxyphenyl)methyl]-1-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 60584518 |
| Molecular Formula | C22H30FN3O |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | N-[(3-ethoxyphenyl)methyl]-1-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]ethanamine |
| SMILES | CCOc1cccc(CNC(C)c2ccc(N3CCN(C)CC3)c(F)c2)c1 |
| InChI | InChI=1S/C22H30FN3O/c1-4-27-20-7-5-6-18(14-20)16-24-17(2)19-8-9-22(21(23)15-19)26-12-10-25(3)11-13-26/h5-9,14-15,17,24H,4,10-13,16H2,1-3H3 |
| InChIKey | BUSQGIYQPVEOHP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|