C18H22FN3 — CID 29038709
(1R)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-N-(pyridin-3-ylmethyl)ethanamine (PubChem CID 29038709) has the molecular formula C18H22FN3 and a molecular weight of 299.39 g/mol. Its IUPAC name is (1R)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-N-(pyridin-3-ylmethyl)ethanamine.
| Compound Name | (1R)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-N-(pyridin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 29038709 |
| Molecular Formula | C18H22FN3 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | (1R)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-N-(pyridin-3-ylmethyl)ethanamine |
| SMILES | C[C@@H](NCc1cccnc1)c1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C18H22FN3/c1-14(21-13-15-5-4-8-20-12-15)16-6-7-18(17(19)11-16)22-9-2-3-10-22/h4-8,11-12,14,21H,2-3,9-10,13H2,1H3/t14-/m1/s1 |
| InChIKey | BAAXYGLNXRQBAB-CQSZACIVSA-N |
| XLogP | 3.67 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|