C17H27FN2 — CID 29064023
N-[(1R)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)ethyl]pentan-1-amine (PubChem CID 29064023) has the molecular formula C17H27FN2 and a molecular weight of 278.42 g/mol. Its IUPAC name is N-[(1R)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)ethyl]pentan-1-amine.
| Compound Name | N-[(1R)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 29064023 |
| Molecular Formula | C17H27FN2 |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | N-[(1R)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)ethyl]pentan-1-amine |
| SMILES | CCCCCN[C@H](C)c1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C17H27FN2/c1-3-4-5-10-19-14(2)15-8-9-17(16(18)13-15)20-11-6-7-12-20/h8-9,13-14,19H,3-7,10-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | ZMXQUJBRXWSYTN-CQSZACIVSA-N |
| XLogP | 4.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|