C13H19F2N — CID 43177678
N-[1-(3,4-difluorophenyl)ethyl]pentan-1-amine (PubChem CID 43177678) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]pentan-1-amine.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 43177678 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]pentan-1-amine |
| SMILES | CCCCCNC(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H19F2N/c1-3-4-5-8-16-10(2)11-6-7-12(14)13(15)9-11/h6-7,9-10,16H,3-5,8H2,1-2H3 |
| InChIKey | VWBPSZLWAFHJPS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|