C15H23F2NS — CID 104537272
N-[1-(3,4-difluorophenyl)ethyl]-6-methylsulfanylhexan-1-amine (PubChem CID 104537272) has the molecular formula C15H23F2NS and a molecular weight of 287.42 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-6-methylsulfanylhexan-1-amine.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-6-methylsulfanylhexan-1-amine |
|---|---|
| PubChem CID | 104537272 |
| Molecular Formula | C15H23F2NS |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-6-methylsulfanylhexan-1-amine |
| SMILES | CSCCCCCCNC(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H23F2NS/c1-12(13-7-8-14(16)15(17)11-13)18-9-5-3-4-6-10-19-2/h7-8,11-12,18H,3-6,9-10H2,1-2H3 |
| InChIKey | DPOXPFLWCPVTRL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|