C13H19BrFNS — CID 115721432
N-[1-(3-bromo-4-fluorophenyl)ethyl]-4-methylsulfanylbutan-1-amine (PubChem CID 115721432) has the molecular formula C13H19BrFNS and a molecular weight of 320.27 g/mol. Its IUPAC name is N-[1-(3-bromo-4-fluorophenyl)ethyl]-4-methylsulfanylbutan-1-amine.
| Compound Name | N-[1-(3-bromo-4-fluorophenyl)ethyl]-4-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 115721432 |
| Molecular Formula | C13H19BrFNS |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-[1-(3-bromo-4-fluorophenyl)ethyl]-4-methylsulfanylbutan-1-amine |
| SMILES | CSCCCCNC(C)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H19BrFNS/c1-10(16-7-3-4-8-17-2)11-5-6-13(15)12(14)9-11/h5-6,9-10,16H,3-4,7-8H2,1-2H3 |
| InChIKey | MUMAGZVVCXLRHB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|