C14H22FNOS — CID 115879339
N-[1-(4-fluoro-3-methoxyphenyl)ethyl]-4-methylsulfanylbutan-1-amine (PubChem CID 115879339) has the molecular formula C14H22FNOS and a molecular weight of 271.40 g/mol. Its IUPAC name is N-[1-(4-fluoro-3-methoxyphenyl)ethyl]-4-methylsulfanylbutan-1-amine.
| Compound Name | N-[1-(4-fluoro-3-methoxyphenyl)ethyl]-4-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 115879339 |
| Molecular Formula | C14H22FNOS |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[1-(4-fluoro-3-methoxyphenyl)ethyl]-4-methylsulfanylbutan-1-amine |
| SMILES | COc1cc(C(C)NCCCCSC)ccc1F |
| InChI | InChI=1S/C14H22FNOS/c1-11(16-8-4-5-9-18-3)12-6-7-13(15)14(10-12)17-2/h6-7,10-11,16H,4-5,8-9H2,1-3H3 |
| InChIKey | UXCRAUDMDNVNBV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|