C15H24F2N2 — CID 103716762
N-[1-(3,4-difluorophenyl)ethyl]-N'-methyl-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 103716762) has the molecular formula C15H24F2N2 and a molecular weight of 270.37 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-N'-methyl-N'-propan-2-ylpropane-1,3-diamine.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-N'-methyl-N'-propan-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 103716762 |
| Molecular Formula | C15H24F2N2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-N'-methyl-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | CC(NCCCN(C)C(C)C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H24F2N2/c1-11(2)19(4)9-5-8-18-12(3)13-6-7-14(16)15(17)10-13/h6-7,10-12,18H,5,8-9H2,1-4H3 |
| InChIKey | KKDHJZVDPVSAFT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|