About 1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]-N-ethylethanamine
1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]-N-ethylethanamine (PubChem CID 65281352) has the molecular formula C18H29FN2
and a molecular weight of 292.44 g/mol. Its IUPAC name is 1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]-N-ethylethanamine.
Molecular Properties
| Compound Name | 1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]-N-ethylethanamine |
| PubChem CID | 65281352 |
| Molecular Formula | C18H29FN2 |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]-N-ethylethanamine |
| SMILES | CCNC(C)c1ccc(N2CCCC(C)(C)CC2)c(F)c1 |
| InChI | InChI=1S/C18H29FN2/c1-5-20-14(2)15-7-8-17(16(19)13-15)21-11-6-9-18(3,4)10-12-21/h7-8,13-14,20H,5-6,9-12H2,1-4H3 |
| InChIKey | BZMTXJCSXNVLTI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]-N-ethylethanamine?
The IUPAC name of 1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]-N-ethylethanamine (CID 65281352) is 1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]-N-ethylethanamine.
What is the SMILES notation for 1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]-N-ethylethanamine?
The canonical SMILES for 1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]-N-ethylethanamine is CCNC(C)c1ccc(N2CCCC(C)(C)CC2)c(F)c1.
What is the InChIKey of 1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]-N-ethylethanamine?
The InChIKey is BZMTXJCSXNVLTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29FN2/c1-5-20-14(2)15-7-8-17(16(19)13-15)21-11-6-9-18(3,4)10-12-21/h7-8,13-14,20H,5-6,9-12H2,1-4H3.
What are the key properties of 1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]-N-ethylethanamine?
1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]-N-ethylethanamine has a molecular weight of 292.44 g/mol, XLogP of 4.51, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]-N-ethylethanamine is sourced from PubChem (CID 65281352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).