C16H25FN2 — CID 79005160
(1S)-1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]ethanamine (PubChem CID 79005160) has the molecular formula C16H25FN2 and a molecular weight of 264.39 g/mol. Its IUPAC name is (1S)-1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]ethanamine.
| Compound Name | (1S)-1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]ethanamine |
|---|---|
| PubChem CID | 79005160 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | (1S)-1-[4-(4,4-dimethylazepan-1-yl)-3-fluorophenyl]ethanamine |
| SMILES | C[C@H](N)c1ccc(N2CCCC(C)(C)CC2)c(F)c1 |
| InChI | InChI=1S/C16H25FN2/c1-12(18)13-5-6-15(14(17)11-13)19-9-4-7-16(2,3)8-10-19/h5-6,11-12H,4,7-10,18H2,1-3H3/t12-/m0/s1 |
| InChIKey | DYFZIFHSGRAUJJ-LBPRGKRZSA-N |
| XLogP | 3.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |