C12H19Cl2FN2 — CID 112758006
1-(3-fluoro-4-pyrrolidin-1-ylphenyl)ethanamine;dihydrochloride (PubChem CID 112758006) has the molecular formula C12H19Cl2FN2 and a molecular weight of 281.20 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyrrolidin-1-ylphenyl)ethanamine;dihydrochloride.
| Compound Name | 1-(3-fluoro-4-pyrrolidin-1-ylphenyl)ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 112758006 |
| Molecular Formula | C12H19Cl2FN2 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-(3-fluoro-4-pyrrolidin-1-ylphenyl)ethanamine;dihydrochloride |
| SMILES | CC(N)c1ccc(N2CCCC2)c(F)c1.Cl.Cl |
| InChI | InChI=1S/C12H17FN2.2ClH/c1-9(14)10-4-5-12(11(13)8-10)15-6-2-3-7-15;;/h4-5,8-9H,2-3,6-7,14H2,1H3;2*1H |
| InChIKey | RZGYDYKQNHJDLX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |