C18H21FN2 — CID 62205579
1-[4-(1,3-dihydroisoindol-2-yl)-3-fluorophenyl]-N-ethylethanamine (PubChem CID 62205579) has the molecular formula C18H21FN2 and a molecular weight of 284.38 g/mol. Its IUPAC name is 1-[4-(1,3-dihydroisoindol-2-yl)-3-fluorophenyl]-N-ethylethanamine.
| Compound Name | 1-[4-(1,3-dihydroisoindol-2-yl)-3-fluorophenyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 62205579 |
| Molecular Formula | C18H21FN2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 1-[4-(1,3-dihydroisoindol-2-yl)-3-fluorophenyl]-N-ethylethanamine |
| SMILES | CCNC(C)c1ccc(N2Cc3ccccc3C2)c(F)c1 |
| InChI | InChI=1S/C18H21FN2/c1-3-20-13(2)14-8-9-18(17(19)10-14)21-11-15-6-4-5-7-16(15)12-21/h4-10,13,20H,3,11-12H2,1-2H3 |
| InChIKey | LININPKYOUZPAD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|