C16H25FN2O — CID 104959064
1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-N-ethylethanamine (PubChem CID 104959064) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-N-ethylethanamine.
| Compound Name | 1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 104959064 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-N-ethylethanamine |
| SMILES | CCNC(C)c1ccc(N2C[C@@H](C)O[C@@H](C)C2)c(F)c1 |
| InChI | InChI=1S/C16H25FN2O/c1-5-18-13(4)14-6-7-16(15(17)8-14)19-9-11(2)20-12(3)10-19/h6-8,11-13,18H,5,9-10H2,1-4H3/t11-,12+,13? |
| InChIKey | QRSVVDLRLXOZEU-FUNVUKJBSA-N |
| XLogP | 3.11 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|