C15H23FN2O2 — CID 106669966
1-[2-fluoro-4-[1-(propylamino)ethyl]phenyl]pyrrolidine-3,4-diol (PubChem CID 106669966) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 1-[2-fluoro-4-[1-(propylamino)ethyl]phenyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[2-fluoro-4-[1-(propylamino)ethyl]phenyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106669966 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-[2-fluoro-4-[1-(propylamino)ethyl]phenyl]pyrrolidine-3,4-diol |
| SMILES | CCCNC(C)c1ccc(N2CC(O)C(O)C2)c(F)c1 |
| InChI | InChI=1S/C15H23FN2O2/c1-3-6-17-10(2)11-4-5-13(12(16)7-11)18-8-14(19)15(20)9-18/h4-5,7,10,14-15,17,19-20H,3,6,8-9H2,1-2H3 |
| InChIKey | UKSMWQVHTQOSKT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|