C18H23FN4O — CID 94193156
(1R)-1-(3-fluoro-4-methoxyphenyl)-N-[(2-pyrrolidin-1-ylpyrimidin-5-yl)methyl]ethanamine (PubChem CID 94193156) has the molecular formula C18H23FN4O and a molecular weight of 330.41 g/mol. Its IUPAC name is (1R)-1-(3-fluoro-4-methoxyphenyl)-N-[(2-pyrrolidin-1-ylpyrimidin-5-yl)methyl]ethanamine.
| Compound Name | (1R)-1-(3-fluoro-4-methoxyphenyl)-N-[(2-pyrrolidin-1-ylpyrimidin-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 94193156 |
| Molecular Formula | C18H23FN4O |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (1R)-1-(3-fluoro-4-methoxyphenyl)-N-[(2-pyrrolidin-1-ylpyrimidin-5-yl)methyl]ethanamine |
| SMILES | COc1ccc([C@@H](C)NCc2cnc(N3CCCC3)nc2)cc1F |
| InChI | InChI=1S/C18H23FN4O/c1-13(15-5-6-17(24-2)16(19)9-15)20-10-14-11-21-18(22-12-14)23-7-3-4-8-23/h5-6,9,11-13,20H,3-4,7-8,10H2,1-2H3/t13-/m1/s1 |
| InChIKey | YQGOKKOXTQSAIF-CYBMUJFWSA-N |
| XLogP | 3.08 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |