C12H16Cl2FNOS — CID 113261722
N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-methylsulfinylpropan-1-amine (PubChem CID 113261722) has the molecular formula C12H16Cl2FNOS and a molecular weight of 312.24 g/mol. Its IUPAC name is N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-methylsulfinylpropan-1-amine.
| Compound Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-methylsulfinylpropan-1-amine |
|---|---|
| PubChem CID | 113261722 |
| Molecular Formula | C12H16Cl2FNOS |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-methylsulfinylpropan-1-amine |
| SMILES | CC(NCCCS(C)=O)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C12H16Cl2FNOS/c1-8(16-6-3-7-18(2)17)11-9(13)4-5-10(15)12(11)14/h4-5,8,16H,3,6-7H2,1-2H3 |
| InChIKey | XXKFRNTXWCXIGC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|