C14H20Cl2FNO — CID 65105547
3-[[1-(2,6-dichloro-3-fluorophenyl)ethylamino]methyl]pentan-3-ol (PubChem CID 65105547) has the molecular formula C14H20Cl2FNO and a molecular weight of 308.22 g/mol. Its IUPAC name is 3-[[1-(2,6-dichloro-3-fluorophenyl)ethylamino]methyl]pentan-3-ol.
| Compound Name | 3-[[1-(2,6-dichloro-3-fluorophenyl)ethylamino]methyl]pentan-3-ol |
|---|---|
| PubChem CID | 65105547 |
| Molecular Formula | C14H20Cl2FNO |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 3-[[1-(2,6-dichloro-3-fluorophenyl)ethylamino]methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CNC(C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C14H20Cl2FNO/c1-4-14(19,5-2)8-18-9(3)12-10(15)6-7-11(17)13(12)16/h6-7,9,18-19H,4-5,8H2,1-3H3 |
| InChIKey | VWRIGUAYCXLLCD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|