C12H16Cl3FN2O2 — CID 120986789
2-amino-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-methoxypropanamide;hydrochloride (PubChem CID 120986789) has the molecular formula C12H16Cl3FN2O2 and a molecular weight of 345.63 g/mol. Its IUPAC name is 2-amino-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-methoxypropanamide;hydrochloride.
| Compound Name | 2-amino-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-methoxypropanamide;hydrochloride |
|---|---|
| PubChem CID | 120986789 |
| Molecular Formula | C12H16Cl3FN2O2 |
| Molecular Weight | 345.63 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2-amino-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-methoxypropanamide;hydrochloride |
| SMILES | COCC(N)C(=O)NC(C)c1c(Cl)ccc(F)c1Cl.Cl |
| InChI | InChI=1S/C12H15Cl2FN2O2.ClH/c1-6(17-12(18)9(16)5-19-2)10-7(13)3-4-8(15)11(10)14;/h3-4,6,9H,5,16H2,1-2H3,(H,17,18);1H |
| InChIKey | WPDULFSURNHRLK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.63 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|