C14H20Cl3NO2 — CID 79548559
2,2-diethoxy-N-[1-(2,3,4-trichlorophenyl)ethyl]ethanamine (PubChem CID 79548559) has the molecular formula C14H20Cl3NO2 and a molecular weight of 340.68 g/mol. Its IUPAC name is 2,2-diethoxy-N-[1-(2,3,4-trichlorophenyl)ethyl]ethanamine.
| Compound Name | 2,2-diethoxy-N-[1-(2,3,4-trichlorophenyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 79548559 |
| Molecular Formula | C14H20Cl3NO2 |
| Molecular Weight | 340.68 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 2,2-diethoxy-N-[1-(2,3,4-trichlorophenyl)ethyl]ethanamine |
| SMILES | CCOC(CNC(C)c1ccc(Cl)c(Cl)c1Cl)OCC |
| InChI | InChI=1S/C14H20Cl3NO2/c1-4-19-12(20-5-2)8-18-9(3)10-6-7-11(15)14(17)13(10)16/h6-7,9,12,18H,4-5,8H2,1-3H3 |
| InChIKey | OJVCPLZNYQKSFH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|