C13H18Cl3NO — CID 113450013
2-methoxy-2-methyl-N-[1-(2,3,4-trichlorophenyl)ethyl]propan-1-amine (PubChem CID 113450013) has the molecular formula C13H18Cl3NO and a molecular weight of 310.65 g/mol. Its IUPAC name is 2-methoxy-2-methyl-N-[1-(2,3,4-trichlorophenyl)ethyl]propan-1-amine.
| Compound Name | 2-methoxy-2-methyl-N-[1-(2,3,4-trichlorophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 113450013 |
| Molecular Formula | C13H18Cl3NO |
| Molecular Weight | 310.65 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-methoxy-2-methyl-N-[1-(2,3,4-trichlorophenyl)ethyl]propan-1-amine |
| SMILES | COC(C)(C)CNC(C)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H18Cl3NO/c1-8(17-7-13(2,3)18-4)9-5-6-10(14)12(16)11(9)15/h5-6,8,17H,7H2,1-4H3 |
| InChIKey | KDXDSTGPTRGYNL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|