C13H19Cl3N2O2S — CID 63861056
N-[2-methyl-1-[1-(2,3,4-trichlorophenyl)ethylamino]propan-2-yl]methanesulfonamide (PubChem CID 63861056) has the molecular formula C13H19Cl3N2O2S and a molecular weight of 373.73 g/mol. Its IUPAC name is N-[2-methyl-1-[1-(2,3,4-trichlorophenyl)ethylamino]propan-2-yl]methanesulfonamide.
| Compound Name | N-[2-methyl-1-[1-(2,3,4-trichlorophenyl)ethylamino]propan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 63861056 |
| Molecular Formula | C13H19Cl3N2O2S |
| Molecular Weight | 373.73 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | N-[2-methyl-1-[1-(2,3,4-trichlorophenyl)ethylamino]propan-2-yl]methanesulfonamide |
| SMILES | CC(NCC(C)(C)NS(C)(=O)=O)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H19Cl3N2O2S/c1-8(9-5-6-10(14)12(16)11(9)15)17-7-13(2,3)18-21(4,19)20/h5-6,8,17-18H,7H2,1-4H3 |
| InChIKey | SQWAXCNPMBQWRF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.73 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|