C13H16Cl3NO2 — CID 61498523
ethyl 2-[1-(2,3,4-trichlorophenyl)ethylamino]propanoate (PubChem CID 61498523) has the molecular formula C13H16Cl3NO2 and a molecular weight of 324.64 g/mol. Its IUPAC name is ethyl 2-[1-(2,3,4-trichlorophenyl)ethylamino]propanoate.
| Compound Name | ethyl 2-[1-(2,3,4-trichlorophenyl)ethylamino]propanoate |
|---|---|
| PubChem CID | 61498523 |
| Molecular Formula | C13H16Cl3NO2 |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | ethyl 2-[1-(2,3,4-trichlorophenyl)ethylamino]propanoate |
| SMILES | CCOC(=O)C(C)NC(C)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H16Cl3NO2/c1-4-19-13(18)8(3)17-7(2)9-5-6-10(14)12(16)11(9)15/h5-8,17H,4H2,1-3H3 |
| InChIKey | ICHUYBBGRWXIPW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|