C13H14Cl3N — CID 114160570
N-[1-(2,3,4-trichlorophenyl)ethyl]pent-1-yn-3-amine (PubChem CID 114160570) has the molecular formula C13H14Cl3N and a molecular weight of 290.62 g/mol. Its IUPAC name is N-[1-(2,3,4-trichlorophenyl)ethyl]pent-1-yn-3-amine.
| Compound Name | N-[1-(2,3,4-trichlorophenyl)ethyl]pent-1-yn-3-amine |
|---|---|
| PubChem CID | 114160570 |
| Molecular Formula | C13H14Cl3N |
| Molecular Weight | 290.62 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | N-[1-(2,3,4-trichlorophenyl)ethyl]pent-1-yn-3-amine |
| SMILES | C#CC(CC)NC(C)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H14Cl3N/c1-4-9(5-2)17-8(3)10-6-7-11(14)13(16)12(10)15/h1,6-9,17H,5H2,2-3H3 |
| InChIKey | LNLMQWRHNHBAON-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.62 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|