C9H12Cl2N4O2 — CID 102761686
ethyl 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]acetate (PubChem CID 102761686) has the molecular formula C9H12Cl2N4O2 and a molecular weight of 279.13 g/mol. Its IUPAC name is ethyl 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]acetate.
| Compound Name | ethyl 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]acetate |
|---|---|
| PubChem CID | 102761686 |
| Molecular Formula | C9H12Cl2N4O2 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | ethyl 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]acetate |
| SMILES | CCOC(=O)CNc1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H12Cl2N4O2/c1-2-17-7(16)4-13-8-5(10)3-6(11)9(14-8)15-12/h3H,2,4,12H2,1H3,(H2,13,14,15) |
| InChIKey | QTLQALHQGRSSPY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|