C9H11Cl2N3O2 — CID 102756332
ethyl 2-[(6-amino-3,5-dichloro-2-pyridinyl)amino]acetate (PubChem CID 102756332) has the molecular formula C9H11Cl2N3O2 and a molecular weight of 264.11 g/mol. Its IUPAC name is ethyl 2-[(6-amino-3,5-dichloro-2-pyridinyl)amino]acetate.
| Compound Name | ethyl 2-[(6-amino-3,5-dichloro-2-pyridinyl)amino]acetate |
|---|---|
| PubChem CID | 102756332 |
| Molecular Formula | C9H11Cl2N3O2 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | ethyl 2-[(6-amino-3,5-dichloro-2-pyridinyl)amino]acetate |
| SMILES | CCOC(=O)CNc1nc(N)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H11Cl2N3O2/c1-2-16-7(15)4-13-9-6(11)3-5(10)8(12)14-9/h3H,2,4H2,1H3,(H3,12,13,14) |
| InChIKey | ZXQXYKDABQONOE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |