C14H18Cl2N2O3 — CID 108959609
N-(3,5-dichlorophenyl)-N'-(2-methoxyethyl)-2,2-dimethylpropanediamide (PubChem CID 108959609) has the molecular formula C14H18Cl2N2O3 and a molecular weight of 333.22 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-N'-(2-methoxyethyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(3,5-dichlorophenyl)-N'-(2-methoxyethyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108959609 |
| Molecular Formula | C14H18Cl2N2O3 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-(3,5-dichlorophenyl)-N'-(2-methoxyethyl)-2,2-dimethylpropanediamide |
| SMILES | COCCNC(=O)C(C)(C)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O3/c1-14(2,12(19)17-4-5-21-3)13(20)18-11-7-9(15)6-10(16)8-11/h6-8H,4-5H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | GQAYVPFGIYQIFK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|