C15H21BrN2O3 — CID 108959594
N-(4-bromo-3-methylphenyl)-N'-(2-methoxyethyl)-2,2-dimethylpropanediamide (PubChem CID 108959594) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-N'-(2-methoxyethyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-N'-(2-methoxyethyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108959594 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-N'-(2-methoxyethyl)-2,2-dimethylpropanediamide |
| SMILES | COCCNC(=O)C(C)(C)C(=O)Nc1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C15H21BrN2O3/c1-10-9-11(5-6-12(10)16)18-14(20)15(2,3)13(19)17-7-8-21-4/h5-6,9H,7-8H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | JTRGHUPFRHBDFD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|