C9H13Cl2N3O3 — CID 87430180
2,4-dichloro-6-[2-(3-methoxypropoxy)ethoxy]-1,3,5-triazine (PubChem CID 87430180) has the molecular formula C9H13Cl2N3O3 and a molecular weight of 282.13 g/mol. Its IUPAC name is 2,4-dichloro-6-[2-(3-methoxypropoxy)ethoxy]-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-[2-(3-methoxypropoxy)ethoxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 87430180 |
| Molecular Formula | C9H13Cl2N3O3 |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 2,4-dichloro-6-[2-(3-methoxypropoxy)ethoxy]-1,3,5-triazine |
| SMILES | COCCCOCCOc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C9H13Cl2N3O3/c1-15-3-2-4-16-5-6-17-9-13-7(10)12-8(11)14-9/h2-6H2,1H3 |
| InChIKey | VTSVKAFSCOMDGG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|