C12H21ClN4O3 — CID 104561349
4-chloro-N,N-diethyl-6-[2-(2-methoxyethoxy)ethoxy]-1,3,5-triazin-2-amine (PubChem CID 104561349) has the molecular formula C12H21ClN4O3 and a molecular weight of 304.78 g/mol. Its IUPAC name is 4-chloro-N,N-diethyl-6-[2-(2-methoxyethoxy)ethoxy]-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N,N-diethyl-6-[2-(2-methoxyethoxy)ethoxy]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 104561349 |
| Molecular Formula | C12H21ClN4O3 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-chloro-N,N-diethyl-6-[2-(2-methoxyethoxy)ethoxy]-1,3,5-triazin-2-amine |
| SMILES | CCN(CC)c1nc(Cl)nc(OCCOCCOC)n1 |
| InChI | InChI=1S/C12H21ClN4O3/c1-4-17(5-2)11-14-10(13)15-12(16-11)20-9-8-19-7-6-18-3/h4-9H2,1-3H3 |
| InChIKey | ZEZHUYUIXVJHMK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|