C9H11Cl2NO2 — CID 119088450
2,6-dichloro-4-(2-methoxyethoxymethyl)pyridine (PubChem CID 119088450) has the molecular formula C9H11Cl2NO2 and a molecular weight of 236.10 g/mol. Its IUPAC name is 2,6-dichloro-4-(2-methoxyethoxymethyl)pyridine.
| Compound Name | 2,6-dichloro-4-(2-methoxyethoxymethyl)pyridine |
|---|---|
| PubChem CID | 119088450 |
| Molecular Formula | C9H11Cl2NO2 |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 2,6-dichloro-4-(2-methoxyethoxymethyl)pyridine |
| SMILES | COCCOCc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C9H11Cl2NO2/c1-13-2-3-14-6-7-4-8(10)12-9(11)5-7/h4-5H,2-3,6H2,1H3 |
| InChIKey | GVLDUQGCCMHBNH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|