C12H15Cl2NO4 — CID 103181345
2-(3-methoxypropoxy)ethyl 2,6-dichloropyridine-4-carboxylate (PubChem CID 103181345) has the molecular formula C12H15Cl2NO4 and a molecular weight of 308.16 g/mol. Its IUPAC name is 2-(3-methoxypropoxy)ethyl 2,6-dichloropyridine-4-carboxylate.
| Compound Name | 2-(3-methoxypropoxy)ethyl 2,6-dichloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 103181345 |
| Molecular Formula | C12H15Cl2NO4 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2-(3-methoxypropoxy)ethyl 2,6-dichloropyridine-4-carboxylate |
| SMILES | COCCCOCCOC(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO4/c1-17-3-2-4-18-5-6-19-12(16)9-7-10(13)15-11(14)8-9/h7-8H,2-6H2,1H3 |
| InChIKey | AHQAXWYMDQEOKX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|