C11H13Cl2NO4 — CID 71347471
2,2-dimethoxypropyl 2,6-dichloropyridine-4-carboxylate (PubChem CID 71347471) has the molecular formula C11H13Cl2NO4 and a molecular weight of 294.13 g/mol. Its IUPAC name is 2,2-dimethoxypropyl 2,6-dichloropyridine-4-carboxylate.
| Compound Name | 2,2-dimethoxypropyl 2,6-dichloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 71347471 |
| Molecular Formula | C11H13Cl2NO4 |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 2,2-dimethoxypropyl 2,6-dichloropyridine-4-carboxylate |
| SMILES | COC(C)(COC(=O)c1cc(Cl)nc(Cl)c1)OC |
| InChI | InChI=1S/C11H13Cl2NO4/c1-11(16-2,17-3)6-18-10(15)7-4-8(12)14-9(13)5-7/h4-5H,6H2,1-3H3 |
| InChIKey | GNJMQXQJGXSYLH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|