C23H37NO10 — CID 102205051
bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 5-(methylamino)benzene-1,3-dicarboxylate (PubChem CID 102205051) has the molecular formula C23H37NO10 and a molecular weight of 487.55 g/mol. Its IUPAC name is bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 5-(methylamino)benzene-1,3-dicarboxylate.
| Compound Name | bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 5-(methylamino)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 102205051 |
| Molecular Formula | C23H37NO10 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] 5-(methylamino)benzene-1,3-dicarboxylate |
| SMILES | CNc1cc(C(=O)OCCOCCOCCOC)cc(C(=O)OCCOCCOCCOC)c1 |
| InChI | InChI=1S/C23H37NO10/c1-24-21-17-19(22(25)33-14-12-31-10-8-29-6-4-27-2)16-20(18-21)23(26)34-15-13-32-11-9-30-7-5-28-3/h16-18,24H,4-15H2,1-3H3 |
| InChIKey | ZHCKRKIRALVXKS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|