C15H20BrIO5 — CID 11705792
2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-bromo-5-iodo-4-methylbenzoate (PubChem CID 11705792) has the molecular formula C15H20BrIO5 and a molecular weight of 487.13 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-bromo-5-iodo-4-methylbenzoate.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-bromo-5-iodo-4-methylbenzoate |
|---|---|
| PubChem CID | 11705792 |
| Molecular Formula | C15H20BrIO5 |
| Molecular Weight | 487.13 g/mol |
| Exact Mass | 485.95 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-bromo-5-iodo-4-methylbenzoate |
| SMILES | COCCOCCOCCOC(=O)c1cc(Br)c(C)c(I)c1 |
| InChI | InChI=1S/C15H20BrIO5/c1-11-13(16)9-12(10-14(11)17)15(18)22-8-7-21-6-5-20-4-3-19-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | LPYMIFYQOINMAB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.13 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|