C18H20O6 — CID 138976530
2-(2-methoxyethoxy)ethyl 3,5-bis(prop-2-ynoxy)benzoate (PubChem CID 138976530) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 3,5-bis(prop-2-ynoxy)benzoate.
| Compound Name | 2-(2-methoxyethoxy)ethyl 3,5-bis(prop-2-ynoxy)benzoate |
|---|---|
| PubChem CID | 138976530 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 3,5-bis(prop-2-ynoxy)benzoate |
| SMILES | C#CCOc1cc(OCC#C)cc(C(=O)OCCOCCOC)c1 |
| InChI | InChI=1S/C18H20O6/c1-4-6-22-16-12-15(13-17(14-16)23-7-5-2)18(19)24-11-10-21-9-8-20-3/h1-2,12-14H,6-11H2,3H3 |
| InChIKey | NMZLOSAJOAGEDE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|