C21H36N4O8 — CID 102419646
5-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]benzene-1,3-dicarbohydrazide (PubChem CID 102419646) has the molecular formula C21H36N4O8 and a molecular weight of 472.54 g/mol. Its IUPAC name is 5-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]benzene-1,3-dicarbohydrazide.
| Compound Name | 5-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]benzene-1,3-dicarbohydrazide |
|---|---|
| PubChem CID | 102419646 |
| Molecular Formula | C21H36N4O8 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 5-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]benzene-1,3-dicarbohydrazide |
| SMILES | COCCOCCOCCOCCOCCOCCc1cc(C(=O)NN)cc(C(=O)NN)c1 |
| InChI | InChI=1S/C21H36N4O8/c1-28-4-5-30-8-9-32-12-13-33-11-10-31-7-6-29-3-2-17-14-18(20(26)24-22)16-19(15-17)21(27)25-23/h14-16H,2-13,22-23H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | GRYWIXVRCBQDNI-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 165.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|