About 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(aminomethyl)benzoate
2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(aminomethyl)benzoate (PubChem CID 104563130) has the molecular formula C15H23NO5
and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(aminomethyl)benzoate.
Molecular Properties
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(aminomethyl)benzoate |
| PubChem CID | 104563130 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(aminomethyl)benzoate |
| SMILES | COCCOCCOCCOC(=O)c1cccc(CN)c1 |
| InChI | InChI=1S/C15H23NO5/c1-18-5-6-19-7-8-20-9-10-21-15(17)14-4-2-3-13(11-14)12-16/h2-4,11H,5-10,12,16H2,1H3 |
| InChIKey | YHVNOUGORNQQMM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(aminomethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(aminomethyl)benzoate?
The IUPAC name of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(aminomethyl)benzoate (CID 104563130) is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(aminomethyl)benzoate.
What is the SMILES notation for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(aminomethyl)benzoate?
The canonical SMILES for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(aminomethyl)benzoate is COCCOCCOCCOC(=O)c1cccc(CN)c1.
What is the InChIKey of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(aminomethyl)benzoate?
The InChIKey is YHVNOUGORNQQMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO5/c1-18-5-6-19-7-8-20-9-10-21-15(17)14-4-2-3-13(11-14)12-16/h2-4,11H,5-10,12,16H2,1H3.
What are the key properties of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(aminomethyl)benzoate?
2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(aminomethyl)benzoate has a molecular weight of 297.35 g/mol, XLogP of 0.98, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(aminomethyl)benzoate is sourced from PubChem (CID 104563130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).