About methyl 3-(2-aminoethyl)benzoate
methyl 3-(2-aminoethyl)benzoate (PubChem CID 10511548) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is methyl 3-(2-aminoethyl)benzoate.
Molecular Properties
| Compound Name | methyl 3-(2-aminoethyl)benzoate |
| PubChem CID | 10511548 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | methyl 3-(2-aminoethyl)benzoate |
| SMILES | COC(=O)c1cccc(CCN)c1 |
| InChI | InChI=1S/C10H13NO2/c1-13-10(12)9-4-2-3-8(7-9)5-6-11/h2-4,7H,5-6,11H2,1H3 |
| InChIKey | XMXYETFVQPTTJI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-(2-aminoethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2-aminoethyl)benzoate?
The IUPAC name of methyl 3-(2-aminoethyl)benzoate (CID 10511548) is methyl 3-(2-aminoethyl)benzoate.
What is the SMILES notation for methyl 3-(2-aminoethyl)benzoate?
The canonical SMILES for methyl 3-(2-aminoethyl)benzoate is COC(=O)c1cccc(CCN)c1.
What is the InChIKey of methyl 3-(2-aminoethyl)benzoate?
The InChIKey is XMXYETFVQPTTJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-13-10(12)9-4-2-3-8(7-9)5-6-11/h2-4,7H,5-6,11H2,1H3.
What are the key properties of methyl 3-(2-aminoethyl)benzoate?
methyl 3-(2-aminoethyl)benzoate has a molecular weight of 179.22 g/mol, XLogP of 0.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2-aminoethyl)benzoate is sourced from PubChem (CID 10511548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).